|
CAS#: 165612-94-2 Product: Bis(Pentafluorophenyl)Borane No suppilers available for the product. |
| Name | Bis(Pentafluorophenyl)Borane |
|---|---|
| Synonyms | BORANE,BIS(2,3,4,5,6-PENTAFLUOROPHENYL)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12HBF10 |
| Molecular Weight | 345.93 |
| CAS Registry Number | 165612-94-2 |
| SMILES | Fc2c(Bc1c(F)c(F)c(F)c(F)c1F)c(F)c(F)c(F)c2F |
| InChI | 1S/C12HBF10/c14-3-1(4(15)8(19)11(22)7(3)18)13-2-5(16)9(20)12(23)10(21)6(2)17/h13H |
| InChIKey | KDRVTEPPBMBHHA-UHFFFAOYSA-N |
| Boiling point | 247.335°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 103.385°C (Cal.) |
| Refractive index | (Cal.) |
| (1) | Eileen Theuergarten, Danny Schlüns, Jörg Grunenberg, Constantin G. Daniliuc, Peter G. Jones and Matthias Tamm. Intramolecular heterolytic dihydrogen cleavage by a bifunctional frustrated pyrazolylborane Lewis pair, Chem. Commun., 2010, 46, 8561. |
|---|---|
| Market Analysis Reports |