|
CAS#: 16582-03-9 Product: 1,6-Diaminophenazine No suppilers available for the product. |
| Name | 1,6-Diaminophenazine |
|---|---|
| Synonyms | (6-Aminophenazin-1-Yl)Amine; 1,6-Diaminophenazine; 1,6-Phenazinediamine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 |
| CAS Registry Number | 16582-03-9 |
| SMILES | C2=CC=C(N)C3=NC1=CC=CC(=C1N=C23)N |
| InChI | 1S/C12H10N4/c13-7-3-1-5-9-11(7)16-10-6-2-4-8(14)12(10)15-9/h1-6H,13-14H2 |
| InChIKey | FKTKBFVVAFESPW-UHFFFAOYSA-N |
| Density | 1.414g/cm3 (Cal.) |
|---|---|
| Boiling point | 508.62°C at 760 mmHg (Cal.) |
| Flash point | 293.996°C (Cal.) |
| (1) | A. Mateo Alonso, Roberto Horcajada, Helen J. GroombridgeIn part., Reshma Chudasama (née Mandalia), Majid Motevalli, James H. P. Utley and Peter B. Wyatt. Synthesis of phenazine derivatives for use as precursors to electrochemically generated bases, Org. Biomol. Chem., 2005, 3, 2832. |
|---|---|
| Market Analysis Reports |