| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 1,2,3,4-Tetrahydro-Dibenzothiophene |
|---|---|
| Synonyms | Dibenzothiophene, 1,2,3,4-Tetrahydro-; Tetrahydrodibenzothiophene |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12S |
| Molecular Weight | 188.29 |
| CAS Registry Number | 16587-33-0 |
| SMILES | C1=CC=CC2=C1C3=C(S2)CCCC3 |
| InChI | 1S/C12H12S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1,3,5,7H,2,4,6,8H2 |
| InChIKey | JCLPOPNXITXHOR-UHFFFAOYSA-N |
| Density | 1.178g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.642°C at 760 mmHg (Cal.) |
| Flash point | 111.085°C (Cal.) |
| (1) | A. Celzard, J. F. Marêché, G. Furdin, V. Fierro, C. Sayag and J. Pielaszek. Preparation and catalytic activity of active carbon-supported MoC nanoparticles, Green Chem., 2005, 7, 784. |
|---|---|
| Market Analysis Reports |