|
CAS#: 16625-37-9 Product: (7aR,8R,8aS,11S,11aS,11bR,11cR)-8-Ethyldodecahydro-11-methyl-Furo[2,3-h]pyrrolo[3,2,1-jk][1]benzazepin-10(2H)-one No suppilers available for the product. |
| Name | (7aR,8R,8aS,11S,11aS,11bR,11cR)-8-Ethyldodecahydro-11-methyl-Furo[2,3-h]pyrrolo[3,2,1-jk][1]benzazepin-10(2H)-one |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 |
| CAS Registry Number | 16625-37-9 |
| SMILES | [C@@H]34[C@@H]1[C@@H]2N(CC1)CCCC[C@@H]2[C@H]([C@@H]3OC(=O)[C@H]4C)CC |
| InChI | 1S/C17H27NO2/c1-3-11-12-6-4-5-8-18-9-7-13(15(12)18)14-10(2)17(19)20-16(11)14/h10-16H,3-9H2,1-2H3/t10-,11+,12+,13+,14+,15+,16-/m0/s1 |
| InChIKey | ROIHYOJMCBKEER-KRJCKNDRSA-N |
| Density | 1.121g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.648°C at 760 mmHg (Cal.) |
| Flash point | 146.314°C (Cal.) |
| (1) | Chen Jingbo, Chen Jingchao, Xie Yan, Zhang Hongbin. Enantioselective Total Synthesis of (−)-Stenine, Angewandte Chemie International Edition, 2012 |
|---|---|
| Market Analysis Reports |