| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | alpha-Chloro-3,5,7-Trimethyl-1-Adamantaneacetic Acid |
|---|---|
| Synonyms | 2-Chloro-2-(3,5,7-Trimethyl-1-Adamantyl)Ethanoic Acid; Nsc119925 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H23ClO2 |
| Molecular Weight | 270.80 |
| CAS Registry Number | 16668-45-4 |
| SMILES | CC23CC1(CC(CC(C1)(C)C2)(C)C3)C(C(O)=O)Cl |
| InChI | 1S/C15H23ClO2/c1-12-4-13(2)6-14(3,5-12)9-15(7-12,8-13)10(16)11(17)18/h10H,4-9H2,1-3H3,(H,17,18) |
| InChIKey | AIPDCMZNOXKOBM-UHFFFAOYSA-N |
| Density | 1.23g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.619°C at 760 mmHg (Cal.) |
| Flash point | 168.268°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | S. S. Golotvin, E. Vodopianov, R. Pol, B. A. Lefebvre, A. J. Williams, R. D. Rutkowske and T. D. Spitzer. Automated structure verification based on a combination of 1D 1H NMR and 2D 1H–13C HSQC spectra, Magn. Reson. Chem. 2007, 45, 803–813 |
|---|---|
| Market Analysis Reports |