| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| ChemBridge Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 3,5-Di(2-Pyridinyl)-4H-1,2,4-Triazol-4-Amine |
|---|---|
| Synonyms | 3,5-di(2-pyridinyl)-4H-1,2,4-triazol-4-amine; 3,5-di(2-pyridinyl)-4H-1,2,4-triazol-4-ylamine; 3,5-Di(2-pyridinyl)-4H-1,2,4-triazol-4-ylamine # |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10N6 |
| Molecular Weight | 238.25 |
| CAS Registry Number | 1671-88-1 |
| SMILES | C1=CC=NC(=C1)C2=NN=C(N2N)C3=CC=CC=N3 |
| InChI | 1S/C12H10N6/c13-18-11(9-5-1-3-7-14-9)16-17-12(18)10-6-2-4-8-15-10/h1-8H,13H2 |
| InChIKey | VHRKXLULSZZZQT-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 186°C (Expl.) |
| Boiling point | 536.4±48.0°C at 760 mmHg (Cal.) |
| Flash point | 278.2±29.6°C (Cal.) |
| Refractive index | 1.755 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Che-Hsiu Shih, Chou-Fu Sheu, Kenichi Kato, Kunihisa Sugimoto, Jungeun Kim, Yu Wang and Masaki Takata. The photo-induced commensurate modulated structure in site-selective spin crossover complex trans-[Fe(abpt)(NCS)], Dalton Trans., 2010, 39, 9794. |
|---|---|
| Market Analysis Reports |