| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | Tetraphosphorusdecaoxide |
|---|---|
| Synonyms | Diphosphorus Pentoxide; Hsdb 847 |
| Molecular Formula | O10P4 |
| Molecular Weight | 283.89 |
| CAS Registry Number | 16752-60-6 |
| EINECS | 215-236-1 |
| SMILES | O=[P]12O[P]3(O[P](O1)(O[P](O2)(O3)=O)=O)=O |
| InChI | 1S/O10P4/c1-11-5-12(2)8-13(3,6-11)10-14(4,7-11)9-12 |
| InChIKey | DLYUQMMRRRQYAE-UHFFFAOYSA-N |
| Density | 2.5±0.1g/cm3 (Cal.) |
|---|---|
| 2.39 (Expl.) | |
| Melting point | 340°C (Expl.) |
| Boiling point | 360°C (Expl.) |
| Safety Code | S22;S26;S45 Details |
|---|---|
| Risk Code | R35 Details |
| Hazard Symbol | C Details |
| Transport Information | UN1807 |
| Safety Description | DANGER: CORROSIVE, burns skin and eyes |
| (1) | Hui-suk Yun, Haoshen Zhou and Itaru Honma. Synthesis of self-standing mesoporous nanocrystalline titania–phosphorus oxide composite films, Chem. Commun., 2004, 0, 2836. |
|---|---|
| Market Analysis Reports |