| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 8-Iodo-4-Methoxyindolo[2,1-b]Quinazoline-6,12-Dione |
|---|---|
| Synonyms | AIDS168908; AIDS-168908 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H9IN2O3 |
| Molecular Weight | 404.16 |
| CAS Registry Number | 169038-38-4 |
| SMILES | Ic4cc2c(N/1C(=O)c3c(\N=C\1C2=O)c(OC)ccc3)cc4 |
| InChI | 1S/C16H9IN2O3/c1-22-12-4-2-3-9-13(12)18-15-14(20)10-7-8(17)5-6-11(10)19(15)16(9)21/h2-7H,1H3 |
| InChIKey | BODHONFKPSQHDK-UHFFFAOYSA-N |
| Density | 1.93g/cm3 (Cal.) |
|---|---|
| Boiling point | 589.83°C at 760 mmHg (Cal.) |
| Flash point | 310.518°C (Cal.) |
| Refractive index | 1.789 (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |