| AccuStandard Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 786-5290 | |||
![]() |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 3-Nitrophenanthrene |
|---|---|
| Synonyms | Ccris 7647; Nsc107614; Phenanthrene, 3-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.23 |
| CAS Registry Number | 17024-19-0 |
| SMILES | C1=C([N+](=O)[O-])C=CC2=CC=C3C(=C12)C=CC=C3 |
| InChI | 1S/C14H9NO2/c16-15(17)12-8-7-11-6-5-10-3-1-2-4-13(10)14(11)9-12/h1-9H |
| InChIKey | CPRHWWUDRYJODK-UHFFFAOYSA-N |
| Density | 1.317g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.876°C at 760 mmHg (Cal.) |
| Flash point | 214.685°C (Cal.) |
| (1) | Matteo Carrara and Reinhard Niessner. Impact of a NO-regenerated diesel particulate filter on PAH and NPAH emissions from an EURO IV heavy duty engine, J. Environ. Monit., 2011, 13, 3373. |
|---|---|
| Market Analysis Reports |