| Atomole Scientific Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (27) 8262-4262 | |||
![]() |
sales@atomole.com | |||
| Chemical manufacturer since 2008 | ||||
| Name | 2-(Trimethylammonio)Ethyl Hydrogen Phosphate Hydrochloride (1:1) |
|---|---|
| Synonyms | [2-(phosphonooxy)ethyl]trimethylammonium chloride; PC-Cl; phosphocholine chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C5H15ClNO4P |
| Molecular Weight | 219.60 |
| CAS Registry Number | 17032-39-2 |
| SMILES | C[N+](C)(C)CCOP(=O)(O)[O-].Cl |
| InChI | 1S/C5H14NO4P.ClH/c1-6(2,3)4-5-10-11(7,8)9;/h4-5H2,1-3H3,(H-,7,8,9);1H |
| InChIKey | PYJNAPOPMIJKJZ-UHFFFAOYSA-N |
| Refractive index | (Cal.) |
|---|---|
| (1) | Andreas Reisch, Joseph Hemmerlé, Armelle Chassepot, Mathias Lefort, Nadia Benkirane-Jessel, Ermanno Candolfi, Philippe Mésini, Valerie Letscher-Bru, Jean-Claude Voegel and Pierre Schaaf. Anti-fouling phosphorylcholine bearing polyelectrolyte multilayers: Cell adhesion resistance at rest and under stretching, Soft Matter, 2010, 6, 1503. |
|---|---|
| Market Analysis Reports |