Online Database of Chemicals from Around the World

4-Chloro-6-(1-methyl-1H-pyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazine
[CAS 1703794-33-5]

List of Suppliers
Sichuan Taienkang Pharmaceutical Co., Ltd. China
www.taienkangpharma.com
+86 15102825326
sales@taienkangpharma.com
QQ Chat
Skype Chat
Chemical manufacturer since 2020
chemBlink Standard supplier since 2024

Identification
ClassificationOrganic raw materials >> Heterocyclic compound >> Triazines
Name4-Chloro-6-(1-methyl-1H-pyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazine
Molecular Structure4-Chloro-6-(1-methyl-1H-pyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazine molecular structure (CAS 1703794-33-5)
Molecular FormulaC10H8ClN5
Molecular Weight233.66
CAS Registry Number1703794-33-5
SMILESCN1C=C(C=N1)C2=CN3C(=C2)C(=NC=N3)Cl
Properties
Density1.5±0.1 g/cm3, Calc.*
Index of Refraction1.757, Calc.*
*Calculated using Advanced Chemistry Development (ACD/Labs) Software.
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302-H315-H319-H335  Details
Safety StatementsP261-P280-P301+P312-P302+P352-P305+P351+P338  Details
SDSAvailable
up chemBlink Chemical Story
4-Chloro-6-(1-methyl-1H-pyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazine is a synthetic compound that belongs to the pyrrolo[2,1-f][1,2,4]triazine family, which is known for its diverse biological activities. The compound features a triazine core fused to a pyrrole ring, with a chloromethyl group at position 4 and a pyrazolyl group at position 6. This structure imparts a unique set of chemical and biological properties, making it a candidate for various applications in medicinal chemistry and materials science.

The discovery of 4-chloro-6-(1-methyl-1H-pyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazine stemmed from the exploration of triazine derivatives for their potential as biologically active molecules. The incorporation of the pyrazole group was found to enhance the reactivity and stability of the compound, while the chloro group at position 4 provides further versatility for chemical modifications. This combination of features has made the compound an attractive scaffold for drug discovery, particularly in the development of kinase inhibitors and other bioactive molecules.

The synthesis of 4-chloro-6-(1-methyl-1H-pyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazine is typically achieved through methods such as nucleophilic substitution or palladium-catalyzed coupling reactions. These synthetic routes allow for the selective introduction of the pyrazolyl group, which plays a key role in the biological activity of the compound. Researchers have also investigated various optimization strategies to improve yield and selectivity during the synthesis process.

In terms of application, 4-chloro-6-(1-methyl-1H-pyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazine shows promise as a potential therapeutic agent. It is being explored for its ability to inhibit specific kinases involved in cellular signaling, a mechanism that is particularly relevant in the treatment of cancers and other diseases related to dysregulated cell growth. Additionally, the compound's chemical properties make it a candidate for use in advanced materials, such as organic semiconductors, where it could improve device performance.

As research continues, 4-chloro-6-(1-methyl-1H-pyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazine is likely to play a larger role in both the development of new therapeutic agents and the design of novel materials for electronics.

References

2020. Avapritinib. Pharmaceutical Substances.
URL: https://pharmaceutical-substances.thieme.com/ps/search-results?docUri=KD-01-0223
Market Analysis Reports
Related Products
2-Chloro-1-(3-m...  N-[(3-Chloro-1-...  N-[(4-Chloro-3-...  4-Chloro-5-Meth...  8-[3-Chloro-5-[...  (R)-1-[4-Chloro...  4-chloro-6-(1-m...  5-Chloromethyl-...  4-Chloro-6-Meth...  4-Chloro-2-meth...  1-(Chloromethyl...  6-Chloro-5-meth...  3-Chloro-6-meth...  3-(Chloromethyl...  3-Chloro-4-meth...  3-Chloro-5-meth...  3-Chloro-6-meth...  6-Chloro-N3-met...  3-Chloro-6-Meth...  3-Chloro-6-Meth...