| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| ChemBridge Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Name | Diphenylphosphinic Acid Phenyl Ester |
|---|---|
| Synonyms | (Phenoxy-Phenyl-Phosphoryl)Benzene; Iphenylphosphinic Acid, Phenyl Ester; Nsc84360 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H15O2P |
| Molecular Weight | 294.29 |
| CAS Registry Number | 1706-96-3 |
| SMILES | C1=CC=CC=C1O[P](=O)(C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C18H15O2P/c19-21(17-12-6-2-7-13-17,18-14-8-3-9-15-18)20-16-10-4-1-5-11-16/h1-15H |
| InChIKey | CIJWIJSYZZLMGD-UHFFFAOYSA-N |
| Density | 1.214g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.12°C at 760 mmHg (Cal.) |
| Flash point | 222.504°C (Cal.) |
| (1) | Ik-Hwan Um, Jee Eun Park and Young-Hee Shin. Combined dual substituent constant and activation parameter analysis assigns a concerted mechanism to alkaline ethanolysis at phosphorus of Y-substituted phenyl diphenylphosphinates, Org. Biomol. Chem., 2007, 5, 3539. |
|---|---|
| Market Analysis Reports |