| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Tribenzyl Phosphate |
|---|---|
| Synonyms | Phosphoric Acid Tris(Phenylmethyl) Ester; Phosphoric Acid Tris(Benzyl) Ester; Ai3-16305 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H21O4P |
| Molecular Weight | 368.37 |
| CAS Registry Number | 1707-92-2 |
| EINECS | 216-955-3 |
| SMILES | C1=CC=C(C=C1)CO[P](=O)(OCC2=CC=CC=C2)OCC3=CC=CC=C3 |
| InChI | 1S/C21H21O4P/c22-26(23-16-19-10-4-1-5-11-19,24-17-20-12-6-2-7-13-20)25-18-21-14-8-3-9-15-21/h1-15H,16-18H2 |
| InChIKey | OACSUWPJZKGHHK-UHFFFAOYSA-N |
| Density | 1.214g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.833°C at 760 mmHg (Cal.) |
| Flash point | 273.411°C (Cal.) |
| (1) | Ze-Yi Lim, Jan W. Thuring, Andrew B. Holmes, Maria Manifava and Nicholas T. Ktistakis. Synthesis and biological evaluation of a PtdIns(4,5)P and a phosphatidic acid affinity matrix, J. Chem. Soc., Perkin Trans. 1, 2002, 0, 1067. |
|---|---|
| Market Analysis Reports |