| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Aronis | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (926) 578-0336 | |||
![]() |
rakishev@aronis.ru | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Bide Pharmatech Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 4006-147-117 | |||
![]() |
sales@bidepharmatech.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2007 | ||||
| DSL Chemicals (Shanghai) Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (21) 6352-9955 | |||
![]() |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Classification | Chemical reagent >> Organic reagent >> Tosylate |
|---|---|
| Name | 2-Methoxyethyl p-Toluenesulfonate |
| Synonyms | 4-Methylbenzenesulfonic Acid 2-Methoxyethyl Ester; Ethanol, 2-Methoxy-, 4-Methylbenzenesulfonate |
| Molecular Formula | C10H14O4S |
| Molecular Weight | 230.28 |
| CAS Registry Number | 17178-10-8 |
| SMILES | C1=CC(=CC=C1[S](OCCOC)(=O)=O)C |
| InChI | 1S/C10H14O4S/c1-9-3-5-10(6-4-9)15(11,12)14-8-7-13-2/h3-6H,7-8H2,1-2H3 |
| InChIKey | TZXJJSAQSRHKCZ-UHFFFAOYSA-N |
| Density | 1.192g/cm3 (Cal.) |
|---|---|
| Melting point | 10°C (Expl.) |
| Boiling point | 343.95°C at 760 mmHg (Cal.) |
| Flash point | 161.815°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Lassaad Baklouti, Jamila Cherif, Rym Abidi, Françoise Arnaud-Neu, Jack Harrowfield and Jacques Vicens. Synthesis and binding properties of calix[4]arenes with [2 + 2′] mixed ligating functional groups, Org. Biomol. Chem., 2004, 2, 2786. |
|---|---|
| Market Analysis Reports |