| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Classification | Biochemical >> Nucleoside drugs >> Nucleotides and their analogues |
|---|---|
| Name | 2-((2R,3R,4R,5R)-3,4-Dihydroxy-5-(hydroxymethyl)-3-methyltetrahydrofuran-2-yl)-1,2,4-triazine-3,5(2H,4H)-dione |
| Synonyms | 2-(2-C-Methyl-β-D-ribofuranosyl)-1,2,4-triazine-3,5(2H,4H)-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13N3O6 |
| Molecular Weight | 259.22 |
| CAS Registry Number | 172605-95-7 |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1N2C(=O)NC(=O)C=N2)CO)O)O |
| Solubility | 3.616e+004 mg/L (25 °C water) |
|---|---|
| Density | 1.9±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.727, Calc.* |
| Melting point | 242.14 °C |
| Boiling Point | 563.24 °C |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |