| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| chemBlink massive supplier since 2018 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Classification | Chemical reagent >> Deuterated reagent |
|---|---|
| Name | Cyclohexane-1,1,2,2,3,3,4,4,5,5,6,6-D12 |
| Synonyms | Cyclohexane, D12; 269735_Aldrich; (2H12)Cyclohexane |
| Molecular Formula | C6D12 |
| Molecular Weight | 96.24 |
| CAS Registry Number | 1735-17-7 |
| EINECS | 217-077-3 |
| SMILES | C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H] |
| InChI | 1S/C6H12/c1-2-4-6-5-3-1/h1-6H2/i1D2,2D2,3D2,4D2,5D2,6D2 |
| InChIKey | XDTMQSROBMDMFD-LBTWDOQPSA-N |
| Density | 0.89 (Expl.) |
|---|---|
| 0.9±0.1g/cm3 (Cal.) | |
| Melting point | 6.5°C (Expl.) |
| Boiling point | 78°C (Expl.) |
| 80.719°C at 760 mmHg (Cal.) | |
| Flash point | -18.333°C (Cal.) |
| 1°C (Expl.) | |
| Refractive index | 1.421 (Expl.) |
| Safety Code | S9;S16;S33;S60;S61;S62 Details |
|---|---|
| Risk Code | R11;R38;R50/53;R65;R67 Details |
| Hazard Symbol | X;F;N Details |
| Transport Information | UN1145 |
| Safety Description | DANGER: FLAMMABLE, irritates skin, eyes, lungs |
| Safety glasses, good ventilation. | |
| SDS | Available |
| (1) | Georgiy B. Shul’pin, Yuriy N. Kozlov, Galina V. Nizova, Georg Süss-Fink, Sandrine Stanislas, Alex Kitaygorodskiy and Vera S. Kulikova. Oxidations by the reagent “O–HO–vanadium derivative–pyrazine-2-carboxylic acid?. Part 12. Main features, kinetics and mechanism of alkane hydroperoxidation, J. Chem. Soc., Perkin Trans. 2, 2001, 0, 1351. |
|---|---|
| Market Analysis Reports |