| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 4-(4-Bromophenyl)-4,5-Dimethyl-2-Cyclohexen-1-One |
|---|---|
| Synonyms | 4-(4-Bromophenyl)-4,5-dimethyl-2-cyclohexen-1-one # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15BrO |
| Molecular Weight | 279.17 |
| CAS Registry Number | 17429-37-7 |
| SMILES | CC1CC(=O)C=CC1(C)C2=CC=C(C=C2)Br |
| InChI | 1S/C14H15BrO/c1-10-9-13(16)7-8-14(10,2)11-3-5-12(15)6-4-11/h3-8,10H,9H2,1-2H3 |
| InChIKey | CKMKVUDREHULBH-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 307.7±31.0°C at 760 mmHg (Cal.) |
| Flash point | 17.2±12.2°C (Cal.) |
| Refractive index | 1.553 (Cal.) |
| (1) | Hua Yang, Somdev Banerjee and Rich G. Carter. Proline sulphonamide-catalysed Yamada–Otani condensation: reaction development, substrate scope and scaffold reactivity, Org. Biomol. Chem., 2012, 10, 4851. |
|---|---|
| Market Analysis Reports |