| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Name | [4-(4-Methyl-1-Piperazinyl)-10H-Thieno[2,3-b][1,5]Benzodiazepin-2-Yl]Methanol |
|---|---|
| Synonyms | 2-Hydroxy methyl olanzapine; [10-(4-Me |
| Molecular Structure | ![]() |
| Molecular Formula | C17H20N4OS |
| Molecular Weight | 328.43 |
| CAS Registry Number | 174756-45-7 |
| SMILES | CN1CCN(CC1)C2=NC3=CC=CC=C3NC4=C2C=C(S4)CO |
| InChI | 1S/C17H20N4OS/c1-20-6-8-21(9-7-20)16-13-10-12(11-22)23-17(13)19-15-5-3-2-4-14(15)18-16/h2-5,10,19,22H,6-9,11H2,1H3 |
| InChIKey | FPDIERBPQFAFSI-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 530.7±60.0°C at 760 mmHg (Cal.) |
| Flash point | 274.8±32.9°C (Cal.) |
| Refractive index | 1.727 (Cal.) |
| (1) | Sean Ekins, Konstantin V. Balakin, Nikolay Savchuk, and Yan Ivanenkov. Insights for Human Ether-a-Go-Go-Related Gene Potassium Channel Inhibition Using Recursive Partitioning and Kohonen and Sammon Mapping Techniques, J. Med. Chem. 2006, 49(17), 5059-5071. |
|---|---|
| Market Analysis Reports |