| Aronis | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (926) 578-0336 | |||
![]() |
rakishev@aronis.ru | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Frinton Laboratories, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (856) 722-7037 | |||
![]() |
frinton@frinton.com | |||
| Chemical manufacturer | ||||
| Name | 4-[[(4-Methoxyphenyl)Imino]Methyl]-N,N-Dimethyl-Benzenamine |
|---|---|
| Synonyms | 4-[(4-Methoxyphenyl)Iminomethyl]-N,N-Dimethyl-Aniline; [4-[(4-Methoxyphenyl)Iminomethyl]Phenyl]-Dimethyl-Amine; Fr-0707 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 |
| CAS Registry Number | 1749-04-8 |
| SMILES | C1=C(C=CC(=C1)N(C)C)C=NC2=CC=C(OC)C=C2 |
| InChI | 1S/C16H18N2O/c1-18(2)15-8-4-13(5-9-15)12-17-14-6-10-16(19-3)11-7-14/h4-12H,1-3H3 |
| InChIKey | KBXXRLKOQDYBQW-UHFFFAOYSA-N |
| Density | 1.007g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.91°C at 760 mmHg (Cal.) |
| Flash point | 202.916°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Asano T, Furuta H, Hofmann H-J, Cimiraglia R, Tsuno Y, Fujio M. Mechanism of thermal Z/E isomerization of substituted N-benzylideneanilines. Nature of the activated complex with an sp-hybridized nitrogen atom, Journal of Organic Chemistry, 1993, 58(16), 4418-4423 |
|---|---|
| Market Analysis Reports |