| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| MicroCombiChem e.K. | UK | |||
|---|---|---|---|---|
![]() |
+49 (611) 962-5284 | |||
![]() |
info@microcombichem.com | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Ukrorgsyntez Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+38 (044) 531-9497 | |||
![]() |
sales@uorsy.com | |||
| Chemical manufacturer since 2001 | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | N,N''-Bis-(4-Chloro-Phenyl)-Malonamide |
|---|---|
| Synonyms | N,N'-Bis(4-Chlorophenyl)Malonamide; Aids-097040; Aids097040 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12Cl2N2O2 |
| Molecular Weight | 323.18 |
| CAS Registry Number | 17722-20-2 |
| SMILES | C2=C(NC(CC(NC1=CC=C(Cl)C=C1)=O)=O)C=CC(=C2)Cl |
| InChI | 1S/C15H12Cl2N2O2/c16-10-1-5-12(6-2-10)18-14(20)9-15(21)19-13-7-3-11(17)4-8-13/h1-8H,9H2,(H,18,20)(H,19,21) |
| InChIKey | UWWFXRVMMDRCCS-UHFFFAOYSA-N |
| Density | 1.443g/cm3 (Cal.) |
|---|---|
| Boiling point | 597.918°C at 760 mmHg (Cal.) |
| Flash point | 315.409°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |