| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| Name | D-Ribonate |
|---|---|
| Synonyms | D-ribonate; CHEBI:17773 |
| Molecular Structure | ![]() |
| Molecular Formula | C5H9O6 |
| Molecular Weight | 165.12 |
| CAS Registry Number | 17812-24-7 |
| SMILES | [O-]C(=O)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | 1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/p-1/t2-,3-,4-/m1/s1 |
| InChIKey | QXKAIJAYHKCRRA-BXXZVTAOSA-M |
| Boiling point | 583.987°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 321.023°C (Cal.) |
| Refractive index | (Cal.) |
| (1) | Fan Ao, Jaenicke Stephan, Chuah Gaik-Khuan. A heterogeneous Pd–Bi/C catalyst in the synthesis of l-lyxose and l-ribose from naturally occurring d-sugars, Organic & Biomolecular Chemistry, 2011 |
|---|---|
| Market Analysis Reports |