| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Anvia Chemicals, LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (414) 534-7845 | |||
![]() |
sales@anviachem.com | |||
| Chemical manufacturer | ||||
| Classification | Inorganic chemical industry >> Inorganic salt >> Metal halides and halides >> Metal fluorides and salts |
|---|---|
| Name | Nitronium hexafluoroantimonate |
| Synonyms | MFCD00042550; Nitrosonium hexafluoroantimonate; Nitrosonium hexafluoroantimonate(V) 98% |
| Molecular Structure | ![]() |
| Molecular Formula | F6NOSb |
| Molecular Weight | 265.76 |
| CAS Registry Number | 17856-92-7 |
| SMILES | F[Sb-](F)(F)(F)(F)F.[O+]#N |
| InChI | 1S/6FH.NO.Sb/c;;;;;;1-2;/h6*1H;;/q;;;;;;+1;+5/p-6 |
| InChIKey | AMGJCGWYCZRXHS-UHFFFAOYSA-H |
| Refractive index | (Cal.) |
|---|---|
| Safety Description | S22,S24/25,S26,S36/37/39,S45 |
|---|---|
| R34,R36/37/38 | |
| Corrosive/Harmful/Moisture Sensitive/Hygroscopic/Store under Argon/Keep Cold | |
| SDS | Available |
| Market Analysis Reports |