|
CAS#: 1786-12-5 Product: 1,7,11-Trimethyl-4-propan-2-yl-cyclotetradecane No suppilers available for the product. |
| Name | 1,7,11-Trimethyl-4-propan-2-yl-cyclotetradecane |
|---|---|
| Synonyms | 4-Isopropyl-1,7,11-Trimethyl-Cyclotetradecane; 4-Isopropyl-1,7,11-Trimethylcyclotetradecane; 1,7,11-Trimethyl-4-Propan-2-Yl-Cyclotetradecane |
| Molecular Structure | ![]() |
| Molecular Formula | C20H40 |
| Molecular Weight | 280.54 |
| CAS Registry Number | 1786-12-5 |
| SMILES | CC1CCCC(CCCC(CCC(CC1)C(C)C)C)C |
| InChI | 1S/C20H40/c1-16(2)20-14-12-18(4)10-6-8-17(3)9-7-11-19(5)13-15-20/h16-20H,6-15H2,1-5H3 |
| InChIKey | LHORCXXUZJAMPU-UHFFFAOYSA-N |
| Density | 0.778g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.106°C at 760 mmHg (Cal.) |
| Flash point | 162.82°C (Cal.) |
| (1) | Harald Gross, Stefan Kehraus, Markus Nett, Gabriele M. König, Winfried Beil and Anthony D. Wright. New cytotoxic cembrane based diterpenes from the soft corals Sarcophyton cherbonnieri and Nephthea sp., Org. Biomol. Chem., 2003, 1, 944. |
|---|---|
| Market Analysis Reports |