Online Database of Chemicals from Around the World
4-[(1S)-2-[(1S,4As,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-hydroxyethyl]-2H-furan-5-one
[CAS 1788090-69-6]
Identification| Name | 4-[(1S)-2-[(1S,4As,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-hydroxyethyl]-2H-furan-5-one |
|---|
|
| Molecular Structure | ![4-[(1S)-2-[(1S,4As,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-hydroxyethyl]-2H-furan-5-one molecular structure (CAS 1788090-69-6)](/structures/1788090-69-6.png) |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.45 |
| CAS Registry Number | 1788090-69-6 |
| SMILES | C[C@]12CCCC([C@@H]1CCC(=C)[C@@H]2C[C@@H](C3=CCOC3=O)O)(C)C |
|
Properties
| Solubility | 4.476 mg/L (25 °C water) |
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.535, Calc.* |
| Melting point | 163.32 °C |
| Boiling Point | 430.37 °C, 468.0±20.0 °C (760 mmHg), Calc.* |
| Flash Point | 187.5±14.5 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Related Products
N-[3,4,7-Trimet... (3S,5S,9R,10S,1... (3S,4R,5S,10S,1... 3-[3,4a,6-Trime... 1,3,3-Trimethyl... 8,10,13-Trimeth... (1R,9S)-4,11,11... (3Z)-4,11,11-Tr... 1,5,5-Trimethyl... (1Z,5E)-1,4,4-T... 1,3,3-Trimethyl... 1,7,7-Trimethyl... [(1R,4Z,7R,8Z,1... [(1R,4Z,8Z,10S,... (4Z)-6,7,8-Trim... (2E)-N,3,7-Trim... (6Z)-N,N,1-Trim... 1,3,3-trimethyl... 1,2,3-Trimethyl... 1,3,3-trimethyl...