| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | Triethoxy(2-Thienyl)Silane |
|---|---|
| Synonyms | Triethoxy-2-thienylsilane; TRIETHYOXY-2-THIENYLSILANE97; 597007_ALDRICH |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18O3SSi |
| Molecular Weight | 246.40 |
| CAS Registry Number | 17984-89-3 |
| SMILES | CCO[Si](C1=CC=CS1)(OCC)OCC |
| InChI | 1S/C10H18O3SSi/c1-4-11-15(12-5-2,13-6-3)10-8-7-9-14-10/h7-9H,4-6H2,1-3H3 |
| InChIKey | ZRQAIBMAFLMIND-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 247.2±13.0°C at 760 mmHg (Cal.) |
| Flash point | 103.3±19.8°C (Cal.) |
| Refractive index | 1.483 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Enrique Font-Sanchis, Ángela Sastre-Santos and Fernando Fernández-Lázaro. Fluoride-triggered indium-mediated synthesis of (hetero)biaryls, Dalton Trans., 2009, 2470. |
|---|---|
| Market Analysis Reports |