|
CAS#: 180179-68-4 Product: N-(3-Chloro-1,4-dihydro-1,4-dioxo-2-naphthalenyl)-L-leucine compd. with morpholine (1:1) No suppilers available for the product. |
| Name | N-(3-Chloro-1,4-dihydro-1,4-dioxo-2-naphthalenyl)-L-leucine compd. with morpholine (1:1) |
|---|---|
| Synonyms | (2S)-2-[(3-Chloro-1,4-Dioxo-2-Naphthyl)Amino]-4-Methyl-Pentanoic Acid; Morpholine; (2S)-2-[(3-Chloro-1,4-Dioxo-2-Naphthyl)Amino]-4-Methylpentanoic Acid; Morpholine; (2S)-2-[(3-Chloro-1,4-Diketo-2-Naphthyl)Amino]-4-Methyl-Valeric Acid; Morpholine |
| Molecular Structure | ![]() |
| Molecular Formula | C20H25ClN2O5 |
| Molecular Weight | 408.88 |
| CAS Registry Number | 180179-68-4 |
| SMILES | [C@@H](NC1=C(Cl)C(=O)C2=C(C1=O)C=CC=C2)(C(=O)O)CC(C)C.C3OCCNC3 |
| InChI | 1S/C16H16ClNO4.C4H9NO/c1-8(2)7-11(16(21)22)18-13-12(17)14(19)9-5-3-4-6-10(9)15(13)20;1-3-6-4-2-5-1/h3-6,8,11,18H,7H2,1-2H3,(H,21,22);5H,1-4H2/t11-;/m0./s1 |
| InChIKey | VDQNPWJSIMJKCE-MERQFXBCSA-N |
| Boiling point | 471.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 238.9°C (Cal.) |
| Market Analysis Reports |