Online Database of Chemicals from Around the World

Methyl 2-amino-4-bromo-3-fluorobenzoate
[CAS 1825390-63-3]

List of Suppliers
Shanghai Zhuyao Pharmaceutical Technology Co., Ltd. China
cn.pharmalego.com
+86 (021) 5859-6383
marketing@pharmalego.com
QQ Chat
Chemical manufacturer since 2023
chemBlink Standard supplier since 2024

Identification
ClassificationOrganic raw materials >> Organic fluorine compound >> Fluorobenzoic acid series
NameMethyl 2-amino-4-bromo-3-fluorobenzoate
Molecular StructureMethyl 2-amino-4-bromo-3-fluorobenzoate molecular structure (CAS 1825390-63-3)
Molecular FormulaC8H7BrFNO2
Molecular Weight248.05
CAS Registry Number1825390-63-3
SMILESCOC(=O)C1=C(C(=C(C=C1)Br)F)N
Properties
Density1.7±0.1 g/cm3, Calc.*
Index of Refraction1.580, Calc.*
Boiling Point313.2±42.0 °C (760 mmHg), Calc.*
Flash Point143.2±27.9 °C, Calc.*
*Calculated using Advanced Chemistry Development (ACD/Labs) Software.
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302-H315-H319-H335  Details
Safety StatementsP261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501  Details
SDSAvailable
up Discovery and Applications
Methyl 2-amino-4-bromo-3-fluorobenzoate is an organic compound that belongs to the family of substituted benzoates. This chemical is characterized by the presence of an amino group, a bromine atom, and a fluorine atom attached to a benzene ring, with a methyl ester group at the carboxyl position. The combination of halogen substituents (bromine and fluorine) on the aromatic ring, along with the amino group, significantly influences the compound's chemical reactivity and potential applications in various fields, such as pharmaceutical development and materials science.

The discovery of methyl 2-amino-4-bromo-3-fluorobenzoate likely emerged from ongoing research focused on the modification of benzene derivatives to enhance their reactivity, biological activity, or suitability for specific applications. Aromatic compounds, especially those containing functional groups like amino, bromine, and fluorine, have been widely studied for their versatility in synthesizing more complex molecules. The particular substitution pattern of this compound makes it a valuable intermediate in organic synthesis, especially for the creation of bioactive molecules or materials with specialized properties.

In pharmaceutical research, methyl 2-amino-4-bromo-3-fluorobenzoate is often explored for its potential as a building block in drug design. The amino group can participate in various chemical reactions, including nucleophilic substitution, which makes it a useful intermediate in the synthesis of more complex molecules. Furthermore, the bromine and fluorine atoms can significantly affect the compound's lipophilicity, solubility, and ability to interact with biological targets, such as enzymes, receptors, or ion channels.

Methyl 2-amino-4-bromo-3-fluorobenzoate may also be of interest in the development of agrochemicals. Halogenated benzoates are frequently investigated for their herbicidal or pesticidal properties, as the halogen atoms can enhance the stability and effectiveness of these compounds in agricultural applications. The combination of halogens with an amino group could lead to molecules with enhanced bioactivity, making them more effective at controlling pests or plant diseases.

Additionally, the compound's unique structure and reactivity make it a potential candidate for materials science, particularly in the synthesis of functionalized polymers, dyes, and organic semiconductors. The ability of halogenated aromatic compounds to engage in complex reactions, such as electrophilic aromatic substitution or coupling reactions, allows for the development of materials with specialized electronic, optical, or mechanical properties. These materials could find applications in electronic devices, sensors, or coatings.

In conclusion, methyl 2-amino-4-bromo-3-fluorobenzoate represents a versatile compound with significant potential in various areas, including pharmaceutical development, agrochemicals, and materials science. Its unique combination of functional groups provides a valuable scaffold for the synthesis of more complex bioactive molecules and advanced materials, making it a compound of interest for ongoing research and development.

References

none
Market Analysis Reports
Related Products
Methyl 3-amino-...  Methyl 2-amino-...  Methyl 2-Amino-...  Methyl 5-amino-...  Methyl 2-amino-...  Methyl (1R,2R)-...  Methyl (1R,2S)-...  Methyl 6-amino-...  Methyl 2-amino-...  Methyl 2-amino-...  Methyl 2-Amino-...  Methyl 2-amino-...  Methyl 2-amino-...  Methyl 2-amino-...  Methyl 2-Amino-...  Methyl 6-amino-...  Methyl 2-amino-...  Methyl 4-amino-...  Methyl 2-amino-...  Methyl 2-aMino-...