| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 2,2'-[(E)-1,2-Ethenediyl]Dithiophene |
|---|---|
| Synonyms | 1,2-bis(2-thienyl)ethene; 2-((1E)-2-(2-thienyl)vinyl)thiophene; 2-[(E)-2-(2-Thienyl)ethenyl]thiophene # |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8S2 |
| Molecular Weight | 192.30 |
| CAS Registry Number | 18266-94-9 |
| SMILES | C1=CSC(=C1)/C=C/C2=CC=CS2 |
| InChI | 1S/C10H8S2/c1-3-9(11-7-1)5-6-10-4-2-8-12-10/h1-8H/b6-5+ |
| InChIKey | AYBFWHPZXYPJFW-AATRIKPKSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 133°C (Expl.) |
| Boiling point | 302.4±11.0°C at 760 mmHg (Cal.) |
| Flash point | 100.5±5.5°C (Cal.) |
| Refractive index | 1.728 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Francesca Ercole, Thomas P. Davis and Richard A. Evans. Photo-responsive systems and biomaterials: photochromic polymers, light-triggered self-assembly, surface modification, fluorescence modulation and beyond, Polym. Chem., 2010, 1, 37. |
|---|---|
| Market Analysis Reports |