Online Database of Chemicals from Around the World
1,3-Diethenyl-1,1,3,3-tetramethoxydisiloxane
[CAS 18293-85-1]
Identification| Name | 1,3-Diethenyl-1,1,3,3-tetramethoxydisiloxane |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C8H18O5Si2 |
| Molecular Weight | 250.40 |
| CAS Registry Number | 18293-85-1 |
| EC Number | 838-839-7 |
| SMILES | CO[Si](C=C)(OC)O[Si](C=C)(OC)OC |
|
Safety Data
| Hazard Symbols | GHS02;GHS07;GHS08 Warning Details |
| Risk Statements | H226-H332-H373 Details |
| Safety Statements | P210-P233-P240-P241-P242-P243-P260-P261-P271-P280-P303+P361+P353-P304+P340-P317-P319-P370+P378-P403+P235-P501 Details |
| Hazard Classification |
|
| Hazard | Class | Category Code | Hazard Statement |
| Acute toxicity | Acute Tox. | 4 | H332 |
| Specific target organ toxicity - repeated exposure | STOT RE | 2 | H373 |
| Flammable liquids | Flam. Liq. | 3 | H226 |
|
Related Products
1,2-Di(Ethenyl)... 1,1-Di(Ethenyl)... 1,1-Diethenyl-C... N,N-Di(Ethenyl)... 1,5-Diethenyl-3... 1,8-Diethenylna... Diethenyl-Oxo-T... Diethenyl Tellu... trans-2,3-Dieth... 2,18-Diethenyl-... 7,12-Diethenyl-... 7,12-Diethenyl-... Diethofencarb 2,2-Diethoxyace... N,N-Diethoxyace... 2,2-Diethoxyace... 1,1-Diethoxyace... Diethoxyacetoni... 2',6'-Diethoxya... 2,2-Diethoxyace...