| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | N-Octyl-D-Gluconamide |
|---|---|
| Synonyms | (2R,3S,4R,5R)-2,3,4,5,6-Pentahydroxy-N-Octyl-Hexanamide; N-Octyl-D-Gluconamide |
| Molecular Structure | ![]() |
| Molecular Formula | C14H29NO6 |
| Molecular Weight | 307.39 |
| CAS Registry Number | 18375-61-6 |
| EINECS | 242-254-7 |
| SMILES | [C@@H](CO)([C@H]([C@@H]([C@H](C(NCCCCCCCC)=O)O)O)O)O |
| InChI | 1S/C14H29NO6/c1-2-3-4-5-6-7-8-15-14(21)13(20)12(19)11(18)10(17)9-16/h10-13,16-20H,2-9H2,1H3,(H,15,21)/t10-,11-,12+,13-/m1/s1 |
| InChIKey | KTMBZDQOFPBYBL-FVCCEPFGSA-N |
| Density | 1.207g/cm3 (Cal.) |
|---|---|
| Boiling point | 631.48°C at 760 mmHg (Cal.) |
| Flash point | 335.707°C (Cal.) |
| (1) | Lauren E. Buerkle, Ramiro Galleguillos and Stuart J. Rowan. Nonionic surfactant-induced stabilization and tailorability of sugar-amphiphile hydrogels, Soft Matter, 2011, 7, 6984. |
|---|---|
| Market Analysis Reports |