| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | Lithium Picrate |
|---|---|
| Synonyms | Lithium Picrate; Phenol, 2,4,6-Trinitro-, Lithium Salt |
| Molecular Structure | ![]() |
| Molecular Weight | 235.04 |
| CAS Registry Number | 18390-55-1 |
| EINECS | 242-270-4 |
| SMILES | [Li+].C1=C(C(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])[O-])[N+](=O)[O-] |
| InChI | 1S/C6H3N3O7.Li/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;/h1-2,10H;/q;+1/p-1 |
| InChIKey | XPSAAFFCAJIBSC-UHFFFAOYSA-M |
| Boiling point | 303.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 133.9°C (Cal.) |
| (1) | Shoichi Katsuta, Hajime Nomura, Takuya Egashira, Naoki Kanaya and Yoshihiro Kudo. Highly lithium-ion selective ionophores: macrocyclic trinuclear complexes of methoxy-substituted arene ruthenium bridged by 2,3-pyridinediolate, New J. Chem., 2013, . |
|---|---|
| Market Analysis Reports |