| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 3-Benzoylcoumarin |
|---|---|
| Synonyms | 3-(Oxo-Phenylmethyl)-2-Chromenone; 3-(Benzoyl)Coumarin; 3-Phenylcarbonylchromen-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C16H10O3 |
| Molecular Weight | 250.25 |
| CAS Registry Number | 1846-74-8 |
| SMILES | C1=CC3=C(C=C1)C=C(C(=O)C2=CC=CC=C2)C(O3)=O |
| InChI | 1S/C16H10O3/c17-15(11-6-2-1-3-7-11)13-10-12-8-4-5-9-14(12)19-16(13)18/h1-10H |
| InChIKey | LPBMPRKJYKSRLL-UHFFFAOYSA-N |
| Density | 1.303g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.726°C at 760 mmHg (Cal.) |
| Flash point | 202.015°C (Cal.) |
| (1) | K. C. Majumdar, Srikanta Samanta, Inul Ansary and B. Roy. An unusual one-pot synthesis of 3-benzoylcoumarins and coumarin-3-carbaldehydes from 2-hydroxybenzaldehydes under esterification conditions, RSC Advances, 2012, 2, 2137. |
|---|---|
| Market Analysis Reports |