Online Database of Chemicals from Around the World
4-Chloro-N-[[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1-oxo-1H-isoindol-5-yl]methyl]-α,α-difluorobenzeneacetamide
[CAS 1860875-51-9]
Identification| Name | 4-Chloro-N-[[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1-oxo-1H-isoindol-5-yl]methyl]-α,α-difluorobenzeneacetamide |
|---|
| Synonyms | CC-90009; Eragidomide |
|
| Molecular Structure | ![4-Chloro-N-[[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1-oxo-1H-isoindol-5-yl]methyl]-α,α-difluorobenzeneacetamide molecular structure (CAS 1860875-51-9)](/structures/1860875-51-9.png) |
| Molecular Formula | C22H18ClF2N3O4 |
| Molecular Weight | 461.85 |
| CAS Registry Number | 1860875-51-9 |
| SMILES | O=C1NC(=O)C(N2C(=O)C3=CC=C(C=C3C2)CNC(=O)C(F)(F)C4=CC=C(Cl)C=C4)CC1 |
|
Properties
| Solubility | Practically insoluble (0.030 g/L g/L) (25 °C), Calc.* |
| pKa | 10.66+/-$0.40 (Most acidic 25 °C), Calc.* |
| Density | 1.466±0.06 g/cm3 (20 °C 760 Torr), Calc.* |
| Boiling point | 770.1±60.0 °C (760 Torr), Calc.* |
| Flash point | 419.6±32.9 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software V11.02 (© 1994-2022 ACD/Labs) |
|
Related Products
4-Chloro-1-[5-(... 5-Chloro-1-[5-(... 3-Chloro-1-[5-(... 8-Chloro-1,3-Di... 8-Chloro[1,3]Di... 6-Chloro[1,3]Di... 8-Chloro-1,3-Di... (2S)-2-[(3-Chlo... 4-[[[4-Chloro-2... 2-Chloro-4-(2,5... [(2R,3S,5R)-5-(... [Chloro-[(2S,5R... 5-Chloro-2,6-Di... 4-Chloro-3-(2,4... Chloro(Dioxo)Ur... 1-Chloro-3,5-Di... chloro-dipentox... 4-[1-[[2-Chloro... 2'-Chlorodiphen... 2-Chloro-N,2-Di...