| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 2-Ethoxy-3,5-Dinitropyridine |
|---|---|
| Synonyms | 2-Ethoxy-3,5-Dinitro-Pyridine; Nsc155357 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H7N3O5 |
| Molecular Weight | 213.15 |
| CAS Registry Number | 18617-41-9 |
| SMILES | C1=C(C=C([N+](=O)[O-])C(=N1)OCC)[N+](=O)[O-] |
| InChI | 1S/C7H7N3O5/c1-2-15-7-6(10(13)14)3-5(4-8-7)9(11)12/h3-4H,2H2,1H3 |
| InChIKey | AMKINOKUGGTRQT-UHFFFAOYSA-N |
| Density | 1.451g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.609°C at 760 mmHg (Cal.) |
| Flash point | 161.004°C (Cal.) |
| (1) | Michael R. Crampton, Thomas A. Emokpae, Judith A. K. Howard, Chukwuemeka Isanbor and Raju Mondal. Kinetic and equilibrium studies of s-adduct formation and nucleophilic substitution in the reactions of 2-phenoxy-3,5-dinitropyridine and 2-ethoxy-3,5-dinitropyridine with aliphatic amines in dipolar aprotic solvents, Org. Biomol. Chem., 2003, 1, 1004. |
|---|---|
| Market Analysis Reports |