| Changzhou Jiuwu Chemical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.jiuwuchem.com | |||
![]() | +86 (519) 8512-1086 +86 13775162768 | |||
![]() | +86 (519) 8512-5369 | |||
![]() | info@jiuwuchem.cn | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2009 | ||||
| chemBlink Premium supplier since 2016 | ||||
| Classification | Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyridine compound >> Nitropyridine |
|---|---|
| Name | 3-Bromo-2-methyl-5-nitropyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C6H5BrN2O2 |
| Molecular Weight | 217.02 |
| CAS Registry Number | 186593-42-0 |
| EC Number | 890-935-8 |
| SMILES | CC1=C(C=C(C=N1)[N+](=O)[O-])Br |
| Solubility | Slightly soluble (2.2 g/L) (25 °C), Calc.* |
|---|---|
| Density | 1.709±0.06 g/cm3 (20 °C 760 Torr), Calc.* |
| Boiling point | 270.6±35.0 °C (760 Torr), Calc.* |
| Flash point | 117.4±25.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software V11.02 (©1994-2014 ACD/Labs) |
| Hazard Symbols | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H302-H315-H319-H335 Details | ||||||||||||||||||||
| Safety Statements | P261-P264-P264+P265-P270-P271-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
|
3-Bromo-2-methyl-5-nitropyridine is a significant chemical compound with notable applications in organic chemistry and pharmaceuticals. This compound features a pyridine ring with bromine, methyl, and nitro groups, which endow it with unique properties that are valuable in various chemical processes. The discovery of 3-bromo-2-methyl-5-nitropyridine is rooted in the broader study of halogenated pyridines, which are known for their diverse chemical reactivity. The introduction of bromine, methyl, and nitro groups to the pyridine ring enhances the compound's functionality, making it useful in multiple applications. This compound's distinctive structure contributes to its reactivity and utility in chemical synthesis. One of the primary uses of 3-bromo-2-methyl-5-nitropyridine is in pharmaceutical development. The compound serves as a crucial intermediate in the synthesis of various drug molecules. Its functional groups allow for further chemical transformations, which are essential in creating complex pharmaceutical compounds. For instance, the nitro group can be converted to an amino group, a common modification in drug synthesis that is critical for developing new therapeutic agents. In addition to its pharmaceutical applications, 3-bromo-2-methyl-5-nitropyridine is also employed in the synthesis of agrochemicals. The compound's ability to participate in further chemical reactions makes it valuable for producing substances such as herbicides, fungicides, and insecticides. These agrochemicals benefit from the precise chemical modifications enabled by the 3-bromo-2-methyl-5-nitropyridine structure, enhancing their effectiveness in agricultural applications. The compound's applications extend to materials science as well. The bromine and nitro groups in 3-bromo-2-methyl-5-nitropyridine can be used to modify polymers and other materials, influencing their physical and chemical properties. Incorporating this compound into polymer matrices can lead to the development of materials with improved thermal stability or reactivity, demonstrating its utility beyond traditional chemical synthesis. In summary, 3-bromo-2-methyl-5-nitropyridine is an important chemical compound with diverse applications. Its unique structure, featuring bromine, methyl, and nitro groups on a pyridine ring, enhances its reactivity and functionality. The compound plays a valuable role in pharmaceutical development, agrochemical synthesis, and materials science, underscoring its significance in various fields. References none |
| Market Analysis Reports |