Online Database of Chemicals from Around the World

di(1H-inden-1-yl)dimethylsilane
[CAS 18666-26-7]

List of Suppliers
Zhengzhou Kingorgchem Chemical Technology Co., Ltd. China
www.kingorgchem.com
+86 (371) 6551-1006
+86 (371) 6575-6965
sales@kingorgchem.com
QQ Chat
WeChat: 18625597674
Chemical manufacturer since 2015
chemBlink Standard supplier since 2016

Identification
ClassificationOrganic raw materials >> Organosilicon compound
Namedi(1H-inden-1-yl)dimethylsilane
Synonymsbis(1H-inden-1-yl)-dimethylsilane
Molecular Structuredi(1H-inden-1-yl)dimethylsilane molecular structure (CAS 18666-26-7)
Molecular FormulaC20H20Si
Molecular Weight288.46
CAS Registry Number18666-26-7
SMILESC[Si](C)(C1C=CC2=CC=CC=C12)C3C=CC4=CC=CC=C34
Safety Data
Hazard Symbolssymbol symbol   GHS02;GHS07 Danger  Details
Risk StatementsH315-H319-H228  Details
Safety StatementsP240-P210-P241-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313  Details
SDSAvailable
up Discovery and Applications
Di(1H-inden-1-yl)dimethylsilane is a unique organosilicon compound known for its distinctive structure and diverse applications. This compound consists of a silicon atom bonded to two 1H-inden-1-yl groups and two methyl groups. Its structure imparts several notable properties that make it valuable in various chemical contexts.

The discovery of di(1H-inden-1-yl)dimethylsilane is rooted in the search for versatile organosilicon compounds with enhanced reactivity and stability. The 1H-inden-1-yl groups, known for their aromatic nature, provide a stable framework, while the dimethylsilane moiety introduces silicon into the structure. This combination of features allows for interesting interactions in catalysis and materials science.

In terms of applications, di(1H-inden-1-yl)dimethylsilane is primarily used as a ligand in transition metal chemistry. Its ability to form stable complexes with transition metals makes it useful in various catalytic processes. For instance, it can be employed in hydrocarbon polymerization and other reactions where silicon-based ligands are advantageous. The compound’s structure allows it to stabilize metal centers and influence the reactivity of metal complexes.

Additionally, di(1H-inden-1-yl)dimethylsilane is utilized in materials science for the synthesis of silicon-containing polymers and materials. Its incorporation into polymer matrices can modify the physical properties of the resulting materials, such as enhancing thermal stability or altering mechanical properties.

The unique properties of di(1H-inden-1-yl)dimethylsilane also make it a subject of interest in the development of new materials with specific electronic or optical characteristics. Researchers are exploring its potential in creating advanced materials with tailored properties for various technological applications.

In summary, di(1H-inden-1-yl)dimethylsilane is a valuable organosilicon compound with notable applications in transition metal catalysis and materials science. Its distinctive structure and reactivity contribute to its usefulness in developing new materials and advancing chemical processes.

References

2017. Synthesis and structural study of 3-phenyl-6,7,8,9-tetrahydrocyclopenta[a]naphthalene-containing ansa-complexes of zirconium. Moscow University Chemistry Bulletin.
DOI: 10.3103/s002713141702002x

2008. Palladium-catalyzed arylation of bis(4-bromo-2-methylinden-1-yl)dimethylsilane and related compounds. Russian Chemical Bulletin.
DOI: 10.1007/s11172-008-0325-z
Market Analysis Reports
Related Products
2,2'-Diimino-5,...  1,3-Diiminoisoi...  1,3-Diiminoisoi...  4,6-Diimino-5-m...  2,4-Diimino-6-o...  Diiminosuccinon...  3,8-Diimino-2,4...  1-(2,4-Diimino-...  Diindeno[4,3,2,...  5H-Diindeno[1,2...  Diindium Tricar...  Diindium trisel...  Diindium tritel...  3,3'-Diindolyl ...  2,2-Di(1H-indol...  3,3'-Diindolylm...  3,3'-Diindolyl-...  Diinosine Penta...  Diiodoacetic Ac...  1,3-Diiodoaceto...