|
CAS#: 1870-65-1 Product: Cetamiphen No suppilers available for the product. |
| Name | Cetamiphen |
|---|---|
| Synonyms | 2-Aminoethanol; 2-Phenylbutyric Acid; Butyric Acid, 2-Phenyl-, Compd. With 2-Aminoethanol (1:1); Benzeneacetic Acid, Alpha-Ethyl-, Compd. With 2-Aminoethanol (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 |
| CAS Registry Number | 1870-65-1 |
| SMILES | C1=C(C(C(=O)O)CC)C=CC=C1.C(O)CN |
| InChI | 1S/C10H12O2.C2H7NO/c1-2-9(10(11)12)8-6-4-3-5-7-8;3-1-2-4/h3-7,9H,2H2,1H3,(H,11,12);4H,1-3H2 |
| InChIKey | OBBCMAHJFIJQIK-UHFFFAOYSA-N |
| Boiling point | 272.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 170.2°C (Cal.) |
| Market Analysis Reports |