| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Dibenzo[cd,lm]perylene |
|---|---|
| Synonyms | Brn 1987513; Dibenzo(Cd,Lm)Perylene; Peropyren |
| Molecular Structure | ![]() |
| Molecular Formula | C26H14 |
| Molecular Weight | 326.40 |
| CAS Registry Number | 188-96-5 |
| SMILES | C2=C1C7=C5C(=C4C1=C3C(=C2)C=CC=C3C=C4)C=CC6=C5C(=CC=C6)C=C7 |
| InChI | 1S/C26H14/c1-3-15-7-11-19-21-13-9-17-5-2-6-18-10-14-22(26(21)24(17)18)20-12-8-16(4-1)23(15)25(19)20/h1-14H |
| InChIKey | WCXXBFNWCCIYQO-UHFFFAOYSA-N |
| Density | 1.392g/cm3 (Cal.) |
|---|---|
| Boiling point | 578.963°C at 760 mmHg (Cal.) |
| Flash point | 298.829°C (Cal.) |
| (1) | Alexandru T. Balaban and Milan RandićPermanent address: 3225 Kingman Rd., Ames, IA 50014 USA. Fax: +1 (515) 292-8629.. Partitioning of π-electrons in rings of polycyclic conjugated hydrocarbons. Part 3. Perifusenes, New J. Chem., 2004, 28, 800. |
|---|---|
| Market Analysis Reports |