| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Crescent Chemical Co. Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 348-0333 | |||
![]() |
crescent@creschem.com | |||
| Chemical distributor | ||||
| Name | 10-Azabenzo[a]Pyrene |
|---|---|
| Synonyms | 1-Azabenzo(B)Pyrene; 10-Azabenzo(A)Pyrene; 3-Azabenzo(D)Pyrene |
| Molecular Structure | ![]() |
| Molecular Formula | C19H11N |
| Molecular Weight | 253.30 |
| CAS Registry Number | 189-92-4 |
| SMILES | C1=CC=CC2=C1C=C5C3=C4C(=CC=C23)N=CC=C4C=C5 |
| InChI | 1S/C19H11N/c1-2-4-15-13(3-1)11-14-6-5-12-9-10-20-17-8-7-16(15)18(14)19(12)17/h1-11H |
| InChIKey | PBJQMIJLHFAYGZ-UHFFFAOYSA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.267°C at 760 mmHg (Cal.) |
| Flash point | 216.926°C (Cal.) |
| (1) | Gabriela L. Borosky and Kenneth K. Laali. Oxidized metabolites from benzo[a]pyrene, benzo[e]pyrene, and aza-benzo[a]pyrenes. A computational study of their carbocations formed by epoxide ring opening reactions, Org. Biomol. Chem., 2007, 5, 2234. |
|---|---|
| Market Analysis Reports |