|
CAS#: 18913-35-4 Product: Methyl 2 3-Butadienoate No suppilers available for the product. |
| Name | Methyl 2 3-Butadienoate |
|---|---|
| Synonyms | Buta-2,3-Dienoic Acid Methyl Ester; 2,3-Butadienoic Acid, Methyl Ester; Inchi=1/C5h6o2/C1-3-4-5(6)7-2/H4h,1H2,2H |
| Molecular Structure | ![]() |
| Molecular Formula | C5H6O2 |
| Molecular Weight | 98.10 |
| CAS Registry Number | 18913-35-4 |
| SMILES | COC(=O)[CH]=[C]=[CH2] |
| InChI | 1S/C5H6O2/c1-3-4-5(6)7-2/h4H,1H2,2H3 |
| InChIKey | CYKLAQPZTQQBJU-UHFFFAOYSA-N |
| Density | 0.906g/cm3 (Cal.) |
|---|---|
| Boiling point | 111.341°C at 760 mmHg (Cal.) |
| Flash point | 34.632°C (Cal.) |
| (1) | Jian-Hong Zhang and Ying Cheng. The [3 + 2] cycloaddition reaction of thiazolecarbene-derived C-C-Se 1,3-dipoles: a concise and highly efficient strategy for the construction of multifunctional dihydroselenophenes and selenopheno[2,3-b]pyrazines, Org. Biomol. Chem., 2009, 7, 3264. |
|---|---|
| Market Analysis Reports |