| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Benzo(a)Coronene |
|---|---|
| Synonyms | Benzo-1,2-Coronene; Benzo[A]Coronene |
| Molecular Structure | ![]() |
| Molecular Formula | C28H14 |
| Molecular Weight | 350.42 |
| CAS Registry Number | 190-70-5 |
| SMILES | C1=C4C3=C2C(=C1)C=CC7=C2C6=C5C3=C(C=C4)C=CC5=C8C(=C6C=C7)C=CC=C8 |
| InChI | 1S/C28H14/c1-2-4-20-19(3-1)21-13-11-17-9-7-15-5-6-16-8-10-18-12-14-22(20)28-26(18)24(16)23(15)25(17)27(21)28/h1-14H |
| InChIKey | NQSLOOOUQZYGEB-UHFFFAOYSA-N |
| Density | 1.467g/cm3 (Cal.) |
|---|---|
| Boiling point | 604.839°C at 760 mmHg (Cal.) |
| Flash point | 315.186°C (Cal.) |
| (1) | Abdelwareth A. O. SarhanCurrent address: Chemistry Department, Faculty of Science, Assiut University, Assiut 71516, Egypt. E-mail: elwareth@aun.edu.eg and Carsten Bolm. Iron(iii) chloride in oxidative C–C coupling reactions, Chem. Soc. Rev., 2009, 38, 2730. |
|---|---|
| Market Analysis Reports |