| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | (3,5-Dimethoxy-4-Hydroxyphenyl)Acetone |
|---|---|
| Synonyms | 1-(4-Hydroxy-3,5-Dimethoxy-Phenyl)Propan-2-One; 1-(4-Hydroxy-3,5-Dimethoxy-Phenyl)Acetone |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 |
| CAS Registry Number | 19037-58-2 |
| SMILES | C1=C(C=C(OC)C(=C1OC)O)CC(C)=O |
| InChI | 1S/C11H14O4/c1-7(12)4-8-5-9(14-2)11(13)10(6-8)15-3/h5-6,13H,4H2,1-3H3 |
| InChIKey | JFWTZKQUFCDLNG-UHFFFAOYSA-N |
| Density | 1.153g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.021°C at 760 mmHg (Cal.) |
| Flash point | 130.074°C (Cal.) |
| (1) | Carlo Bonini, Maurizio D'Auria and Rachele Ferri. Singlet oxygen mediated degradation of lignin—isolation of oxidation products from steam-exploded lignin from pine, Photochem. Photobiol. Sci., 2002, 1, 570. |
|---|---|
| Market Analysis Reports |