| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Name | 7-Aminocoumarin |
|---|---|
| Synonyms | 7-Amino-2-Chromenone; 7-Aminocoumarin; 7-Amino-2H-1-Benzopyran-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 |
| CAS Registry Number | 19063-57-1 |
| SMILES | C1=C2C(=CC=C1N)C=CC(=O)O2 |
| InChI | 1S/C9H7NO2/c10-7-3-1-6-2-4-9(11)12-8(6)5-7/h1-5H,10H2 |
| InChIKey | RRHXPUCIXLAHIY-UHFFFAOYSA-N |
| Density | 1.35g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.408°C at 760 mmHg (Cal.) |
| Flash point | 219.327°C (Cal.) |
| (1) | Jenifer Clausell-Tormos, Andrew D. Griffiths and Christoph A. Merten. An automated two-phase microfluidic system for kinetic analyses and the screening of compound libraries, Lab Chip, 2010, 10, 1302. |
|---|---|
| Market Analysis Reports |