| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Tocris Bioscience Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 4-(3-Chlorophenyl)-1,7-Diethylpyrido[2,3-d]Pyrimidin-2(1H)-One |
|---|---|
| Synonyms | [191219-80-4]; YM 976; NCGC00025308-01 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16ClN3O |
| Molecular Weight | 313.78 |
| CAS Registry Number | 191219-80-4 |
| SMILES | CCC1=NC2=C(C=C1)C(=NC(=O)N2CC)C3=CC(=CC=C3)Cl |
| InChI | 1S/C17H16ClN3O/c1-3-13-8-9-14-15(11-6-5-7-12(18)10-11)20-17(22)21(4-2)16(14)19-13/h5-10H,3-4H2,1-2H3 |
| InChIKey | MNHXYNNKDDXKNP-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 485.4±55.0°C at 760 mmHg (Cal.) |
| Flash point | 247.4±31.5°C (Cal.) |
| Refractive index | 1.638 (Cal.) |
| solubility | Soluble to 100 mM in ethanol and to 100 mM in DMSO |
| SDS | Available |
|---|---|
| Market Analysis Reports |