| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 3-Aminophenoxazone |
|---|---|
| Synonyms | 2-Amino-3-Phenoxazinone; Isophenoxazine; Inchi=1/C12h8n2o2/C13-7-5-9-12(6-10(7)15)16-11-4-2-1-3-8(11)14-9/H1-6H,13H |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 |
| CAS Registry Number | 1916-59-2 |
| SMILES | C1=CC=CC3=C1OC2=CC(=O)C(=CC2=N3)N |
| InChI | 1S/C12H8N2O2/c13-7-5-9-12(6-10(7)15)16-11-4-2-1-3-8(11)14-9/h1-6H,13H2 |
| InChIKey | RDJXPXHQENRCNG-UHFFFAOYSA-N |
| Density | 1.458g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.009°C at 760 mmHg (Cal.) |
| Flash point | 172.737°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Komala Pandurangan, Shane Gallagher, Grace G. Morgan, Helge Müller-Bunz and Francesca Paradisi. Structure and antibacterial activity of the silver(i) complex of 2-aminophenoxazine-3-oneCCDC reference numbers 767525 and 767526. For crystallographic data in CIF or other electronic format see DOI: 10.1039/c003515g, Metallomics, 2010, 2, 530. |
|---|---|
| Market Analysis Reports |