Online Database of Chemicals from Around the World

4-[4-(5-Fluoro-2-pyrimidinyl)-1-piperazinyl]aniline
[CAS 1921374-52-8]

List of Suppliers
Chizhou Dongsheng Pharmaceutical Co., Ltd. China
www.dspharmchem.com
+86 (576) 8429-2571
+86 (576) 8429-2560
ksz@dspharmchem.com
Chemical manufacturer since 1995
chemBlink Premium supplier since 2011
Identification
ClassificationOrganic raw materials >> Aryl compounds >> Anilines
Name4-[4-(5-Fluoro-2-pyrimidinyl)-1-piperazinyl]aniline
Molecular Structure4-[4-(5-Fluoro-2-pyrimidinyl)-1-piperazinyl]aniline molecular structure (CAS 1921374-52-8)
Molecular FormulaC14H16FN5
Molecular Weight273.31
CAS Registry Number1921374-52-8
EC Number826-854-1
SMILESC1CN(CCN1C2=CC=C(C=C2)N)C3=NC=C(C=N3)F
Properties
Density1.3±0.1 g/cm3, Calc.*
Index of Refraction1.632, Calc.*
Boiling Point515.9±60.0 °C (760 mmHg), Calc.*
Flash Point265.8±32.9 °C, Calc.*
*Calculated using Advanced Chemistry Development (ACD/Labs) Software.
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302-H315-H319-H335  Details
Safety StatementsP261-P264-P264+P265-P270-P271-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501  Details
Hazard Classification
up    Details
HazardClassCategory CodeHazard Statement
Skin irritationSkin Irrit.2H315
Specific target organ toxicity - single exposureSTOT SE3H335
Acute toxicityAcute Tox.4H302
Eye irritationEye Irrit.2AH319
up Discovery and Applications
4-[4-(5-Fluoro-2-pyrimidinyl)-1-piperazinyl]aniline, also known as a pyrimidine-based aniline derivative, is a chemical compound with significant implications in medicinal chemistry. The compound is recognized for its role as a building block in the synthesis of pharmaceuticals, particularly in the development of drugs targeting various medical conditions.

The discovery of 4-[4-(5-fluoro-2-pyrimidinyl)-1-piperazinyl]aniline can be traced to advancements in the field of medicinal chemistry, where researchers sought to create compounds with enhanced biological activities through the manipulation of molecular structures. This specific derivative combines a piperazine ring with a 5-fluoro-2-pyrimidinyl group, which contributes to its unique pharmacological properties.

In the context of drug development, 4-[4-(5-fluoro-2-pyrimidinyl)-1-piperazinyl]aniline has been investigated for its potential as an active pharmaceutical ingredient. Its structure allows it to interact with biological targets through specific molecular interactions. The incorporation of a fluorinated pyrimidine ring into the aniline structure enhances its metabolic stability and influences its pharmacokinetic properties, which are crucial for the efficacy of therapeutic agents.

The compound has been explored for its potential use in the treatment of various diseases, including cancer and neurological disorders. The piperazine ring, known for its ability to engage in hydrogen bonding and its flexibility, complements the pyrimidine moiety, enabling the compound to bind effectively to its biological targets. Research has shown that derivatives of this compound can act as inhibitors of specific enzymes or receptors involved in disease processes.

In addition to its role in pharmaceutical applications, 4-[4-(5-fluoro-2-pyrimidinyl)-1-piperazinyl]aniline is utilized in the development of research tools and diagnostic agents. Its chemical structure makes it suitable for use in molecular imaging and as a probe in biochemical assays, where it can help elucidate the function of biological molecules and pathways.

The synthesis of 4-[4-(5-fluoro-2-pyrimidinyl)-1-piperazinyl]aniline involves multiple steps, including the preparation of the pyrimidine and piperazine intermediates, followed by their coupling to form the final aniline derivative. Advances in synthetic methodologies have streamlined the production of this compound, making it more accessible for research and development purposes.

Overall, 4-[4-(5-fluoro-2-pyrimidinyl)-1-piperazinyl]aniline represents a key example of how structural modifications in organic chemistry can lead to the discovery of compounds with significant therapeutic potential. Its applications in drug development, research, and diagnostics highlight the importance of chemical innovation in advancing medical science.

References

none
Market Analysis Reports
Related Products
5-Fluoro-2-pyri...  6-Fluoropyrimid...  5-Fluoro-2(1H)-...  5-Fluoropyrimid...  2-Fluoro-4-(2-P...  3-Fluoro-2-(pyr...  (3R)-3-(5-Fluor...  N-(2-Fluoro-5-P...  2-[(5-Fluoro-4-...  4-Fluoro-1-[3-(...  3-(5-Fluoro-2-P...  (2E)-3-(5-Fluor...  3-(5-Fluoro-2-P...  3-(5-Fluoro-2-P...  N-[1-(5-Fluoro-...  3-fluoro-1H-pyr...  3-Fluoropyrroli...  N-Cbz-3(S)-fluo...  3(S)-Fluoropyrr...  N-Cbz-3(R)-fluo...