Online Database of Chemicals from Around the World
tert-Butyl (3aS,7aS)-rel-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine-6-carboxylate
[CAS 1932131-90-2]
Identification| Name | tert-Butyl (3aS,7aS)-rel-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine-6-carboxylate |
|---|
|
| Molecular Structure | ![tert-Butyl (3aS,7aS)-rel-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine-6-carboxylate molecular structure (CAS 1932131-90-2)](/structures/1932131-90-2.png) |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 |
| CAS Registry Number | 1932131-90-2 |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2CCN[C@@H]2C1 |
|
Properties
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.489, Calc.* |
| Boiling Point | 313.8±15.0 °C (760 mmHg), Calc.* |
| Flash Point | 143.6±20.4 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Related Products