|
CAS#: 19372-00-0 Product: Trimethyl-[(E)-2-Phenylethenyl]Silane No suppilers available for the product. |
| Name | Trimethyl-[(E)-2-Phenylethenyl]Silane |
|---|---|
| Synonyms | Trimethyl-[(E)-2-Phenylvinyl]Silane; Silane,Trimethyl(2-Phenylethenyl)-,(E)-; Silane, Trimethyl(2-Phenylethenyl)-, (E)- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16Si |
| Molecular Weight | 176.33 |
| CAS Registry Number | 19372-00-0 |
| SMILES | C1=CC=CC=C1\C=C\[Si](C)(C)C |
| InChI | 1S/C11H16Si/c1-12(2,3)10-9-11-7-5-4-6-8-11/h4-10H,1-3H3/b10-9+ |
| InChIKey | FIONWRDVKJFHRC-MDZDMXLPSA-N |
| Density | 0.885g/cm3 (Cal.) |
|---|---|
| Boiling point | 214.1°C at 760 mmHg (Cal.) |
| Flash point | 68.672°C (Cal.) |
| (1) | Yoshihiro Nishimoto, Masayuki Kajioka, Takahiro Saito, Makoto Yasuda and Akio Baba. Direct coupling of alcohols with alkenylsilanes catalyzed by indium trichloride or bismuth tribromide, Chem. Commun., 2008, 6396. |
|---|---|
| Market Analysis Reports |