| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Hexagon Labs | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 977-2723 | |||
![]() |
sales@hexagonlabs.com | |||
| Chemical manufacturer since 2005 | ||||
| Tocris Bioscience Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | (1R,2S,4S)-4-Amino-1,2,4-Cyclopentanetricarboxylic Acid |
|---|---|
| Synonyms | (1R,2S)-4-aminocyclopentane-1,2,4-tricarboxylic acid; (1S,2R,4s)-4-aminocyclopentane-1,2,4-tricarboxylic acid; (1S,2R,4S)-4-Amino-cyclopentane-1,2,4-tricarboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H11NO6 |
| Molecular Weight | 217.18 |
| CAS Registry Number | 194918-76-8 |
| SMILES | C1[C@H]([C@H](C[C@]1(C(=O)O)N)C(=O)O)C(=O)O |
| InChI | 1S/C8H11NO6/c9-8(7(14)15)1-3(5(10)11)4(2-8)6(12)13/h3-4H,1-2,9H2,(H,10,11)(H,12,13)(H,14,15)/t3-,4+,8- |
| InChIKey | FERIKTBTNCSGJS-KIGHRTHISA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.4±45.0°C at 760 mmHg (Cal.) |
| Flash point | 220.2±28.7°C (Cal.) |
| Refractive index | 1.598 (Cal.) |
| solubility | Soluble to 10 mM in water and to 100 mM in 1.1eq. NaOH |
| SDS | Available |
|---|---|
| Market Analysis Reports |