| ChemBridge Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Ethyl 5-Acetyl-2-Methyl-3-Furoate |
|---|---|
| Synonyms | 3-furancarboxylic acid, 5-acetyl-2-methyl-, ethyl ester; ethyl 5-acetyl-2-methyl-3-furoate; ethyl 5-acetyl-2-methylfuran-3-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 |
| CAS Registry Number | 19615-50-0 |
| SMILES | CCOC(=O)C1=C(OC(=C1)C(=O)C)C |
| InChI | 1S/C10H12O4/c1-4-13-10(12)8-5-9(6(2)11)14-7(8)3/h5H,4H2,1-3H3 |
| InChIKey | ANOCIKNIQRBSKB-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.7±42.0°C at 760 mmHg (Cal.) |
| Flash point | 137.5±27.9°C (Cal.) |
| Refractive index | 1.483 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Hisahiro Hagiwara, Kouji Sato, Daisuke Nishino, Takashi Hoshi, Toshio Suzuki and Masayoshi Ando. Domino Michael–O-alkylation reaction: one-pot synthesis of 2,4-diacylhydrofuran derivatives and its application to antitumor naphthofuran synthesis, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 2946. |
|---|---|
| Market Analysis Reports |